C23H22Cl2N2O — CID 139583068
N-[(4-tert-butylphenyl)methyl]-2,4-dichloro-N-pyridin-2-ylbenzamide (PubChem CID 139583068) has the molecular formula C23H22Cl2N2O and a molecular weight of 413.35 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-2,4-dichloro-N-pyridin-2-ylbenzamide.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-2,4-dichloro-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 139583068 |
| Molecular Formula | C23H22Cl2N2O |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-2,4-dichloro-N-pyridin-2-ylbenzamide |
| SMILES | CC(C)(C)c1ccc(CN(C(=O)c2ccc(Cl)cc2Cl)c2ccccn2)cc1 |
| InChI | InChI=1S/C23H22Cl2N2O/c1-23(2,3)17-9-7-16(8-10-17)15-27(21-6-4-5-13-26-21)22(28)19-12-11-18(24)14-20(19)25/h4-14H,15H2,1-3H3 |
| InChIKey | XMEJALLYXMCUSO-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |