C11H16O3 — CID 139583096
(Z,2E,3R,4S)-2-[(E)-but-2-enylidene]-3,4-dihydroxyhept-5-enal (PubChem CID 139583096) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (Z,2E,3R,4S)-2-[(E)-but-2-enylidene]-3,4-dihydroxyhept-5-enal.
| Compound Name | (Z,2E,3R,4S)-2-[(E)-but-2-enylidene]-3,4-dihydroxyhept-5-enal |
|---|---|
| PubChem CID | 139583096 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (Z,2E,3R,4S)-2-[(E)-but-2-enylidene]-3,4-dihydroxyhept-5-enal |
| SMILES | C/C=C\[C@H](O)[C@H](O)/C(C=O)=C\C=C\C |
| InChI | InChI=1S/C11H16O3/c1-3-5-7-9(8-12)11(14)10(13)6-4-2/h3-8,10-11,13-14H,1-2H3/b5-3+,6-4-,9-7-/t10-,11+/m0/s1 |
| InChIKey | VPDVLNNSGPCYGT-DPCQOWFFSA-N |
| XLogP | 0.99 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|