About Bca 1
Bca 1 (PubChem CID 139583104) has the molecular formula C21H34O5
and a molecular weight of 366.50 g/mol. Its IUPAC name is 3,4-dihydroxy-2-[[5-hydroxy-2-(7-hydroxy-6-methylheptan-2-yl)-5-methylcyclopent-2-en-1-yl]methyl]cyclohex-2-en-1-one.
Molecular Properties
| Compound Name | Bca 1 |
| PubChem CID | 139583104 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 3,4-dihydroxy-2-[[5-hydroxy-2-(7-hydroxy-6-methylheptan-2-yl)-5-methylcyclopent-2-en-1-yl]methyl]cyclohex-2-en-1-one |
| SMILES | CC(CCCC(C)C1=CCC(C1CC2=C(C(CCC2=O)O)O)(C)O)CO |
| InChI | InChI=1S/C21H34O5/c1-13(12-22)5-4-6-14(2)15-9-10-21(3,26)17(15)11-16-18(23)7-8-19(24)20(16)25/h9,13-14,17,19,22,24-26H,4-8,10-12H2,1-3H3 |
| InChIKey | PCLCDPVEEFVAAQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | 579 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze Bca 1 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Bca 1?
The IUPAC name of Bca 1 (CID 139583104) is 3,4-dihydroxy-2-[[5-hydroxy-2-(7-hydroxy-6-methylheptan-2-yl)-5-methylcyclopent-2-en-1-yl]methyl]cyclohex-2-en-1-one.
What is the SMILES notation for Bca 1?
The canonical SMILES for Bca 1 is CC(CCCC(C)C1=CCC(C1CC2=C(C(CCC2=O)O)O)(C)O)CO.
What is the InChIKey of Bca 1?
The InChIKey is PCLCDPVEEFVAAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H34O5/c1-13(12-22)5-4-6-14(2)15-9-10-21(3,26)17(15)11-16-18(23)7-8-19(24)20(16)25/h9,13-14,17,19,22,24-26H,4-8,10-12H2,1-3H3.
What are the key properties of Bca 1?
Bca 1 has a molecular weight of 366.50 g/mol, XLogP of 1.60, 8 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Bca 1 is sourced from PubChem (CID 139583104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).