C20H30O3 — CID 139583133
(1R,2R,6S,9R,10R,11S,13S,14S)-13-hydroxy-11-methoxy-2,6,11,14-tetramethyltetracyclo[7.6.0.01,6.010,14]pentadec-3-en-5-one (PubChem CID 139583133) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1R,2R,6S,9R,10R,11S,13S,14S)-13-hydroxy-11-methoxy-2,6,11,14-tetramethyltetracyclo[7.6.0.01,6.010,14]pentadec-3-en-5-one.
| Compound Name | (1R,2R,6S,9R,10R,11S,13S,14S)-13-hydroxy-11-methoxy-2,6,11,14-tetramethyltetracyclo[7.6.0.01,6.010,14]pentadec-3-en-5-one |
|---|---|
| PubChem CID | 139583133 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1R,2R,6S,9R,10R,11S,13S,14S)-13-hydroxy-11-methoxy-2,6,11,14-tetramethyltetracyclo[7.6.0.01,6.010,14]pentadec-3-en-5-one |
| SMILES | CO[C@@]1(C)C[C@H](O)[C@@]2(C)C[C@]34[C@H](C)C=CC(=O)[C@@]3(C)CC[C@@H]4[C@H]21 |
| InChI | InChI=1S/C20H30O3/c1-12-6-7-14(21)18(3)9-8-13-16-17(2,11-20(12,13)18)15(22)10-19(16,4)23-5/h6-7,12-13,15-16,22H,8-11H2,1-5H3/t12-,13-,15+,16-,17-,18-,19+,20-/m1/s1 |
| InChIKey | CZARTLVUATUXRJ-ABMKFVPVSA-N |
| XLogP | 3.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |