C15H24O4 — CID 139583210
(3S,3aR,4R,6aR)-3-methyl-4-octyl-3,3a,4,6a-tetrahydrofuro[2,3-c]furan-2,6-dione (PubChem CID 139583210) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (3S,3aR,4R,6aR)-3-methyl-4-octyl-3,3a,4,6a-tetrahydrofuro[2,3-c]furan-2,6-dione.
| Compound Name | (3S,3aR,4R,6aR)-3-methyl-4-octyl-3,3a,4,6a-tetrahydrofuro[2,3-c]furan-2,6-dione |
|---|---|
| PubChem CID | 139583210 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (3S,3aR,4R,6aR)-3-methyl-4-octyl-3,3a,4,6a-tetrahydrofuro[2,3-c]furan-2,6-dione |
| SMILES | CCCCCCCC[C@H]1OC(=O)[C@@H]2OC(=O)[C@@H](C)[C@H]12 |
| InChI | InChI=1S/C15H24O4/c1-3-4-5-6-7-8-9-11-12-10(2)14(16)19-13(12)15(17)18-11/h10-13H,3-9H2,1-2H3/t10-,11+,12+,13+/m0/s1 |
| InChIKey | NAWANLRIOOESSK-UMSGYPCISA-N |
| XLogP | 2.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|