C23H31NO5 — CID 139583243
4-hydroxy-3-[(2R,3R,5S,6S)-6-[(2R,3S)-3-hydroxybutan-2-yl]-3,5-dimethyloxan-2-yl]-1-methoxy-5-phenylpyridin-2-one (PubChem CID 139583243) has the molecular formula C23H31NO5 and a molecular weight of 401.50 g/mol. Its IUPAC name is 4-hydroxy-3-[(2R,3R,5S,6S)-6-[(2R,3S)-3-hydroxybutan-2-yl]-3,5-dimethyloxan-2-yl]-1-methoxy-5-phenylpyridin-2-one.
| Compound Name | 4-hydroxy-3-[(2R,3R,5S,6S)-6-[(2R,3S)-3-hydroxybutan-2-yl]-3,5-dimethyloxan-2-yl]-1-methoxy-5-phenylpyridin-2-one |
|---|---|
| PubChem CID | 139583243 |
| Molecular Formula | C23H31NO5 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 4-hydroxy-3-[(2R,3R,5S,6S)-6-[(2R,3S)-3-hydroxybutan-2-yl]-3,5-dimethyloxan-2-yl]-1-methoxy-5-phenylpyridin-2-one |
| SMILES | COn1cc(-c2ccccc2)c(O)c([C@@H]2O[C@H]([C@H](C)[C@H](C)O)[C@@H](C)C[C@H]2C)c1=O |
| InChI | InChI=1S/C23H31NO5/c1-13-11-14(2)22(29-21(13)15(3)16(4)25)19-20(26)18(12-24(28-5)23(19)27)17-9-7-6-8-10-17/h6-10,12-16,21-22,25-26H,11H2,1-5H3/t13-,14+,15+,16-,21-,22+/m0/s1 |
| InChIKey | SHGAESAOOZYSHY-FNUUGWLLSA-N |
| XLogP | 3.40 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |