C26H43N3O6 — CID 139583249
(3R,6S,9E)-14-(1-hydroxy-4-methyldecan-3-yl)-6-methyl-11-methylidene-3-propan-2-yl-1-oxa-4,7,12-triazacyclotetradec-9-ene-2,5,8,13-tetrone (PubChem CID 139583249) has the molecular formula C26H43N3O6 and a molecular weight of 493.65 g/mol. Its IUPAC name is (3R,6S,9E)-14-(1-hydroxy-4-methyldecan-3-yl)-6-methyl-11-methylidene-3-propan-2-yl-1-oxa-4,7,12-triazacyclotetradec-9-ene-2,5,8,13-tetrone.
| Compound Name | (3R,6S,9E)-14-(1-hydroxy-4-methyldecan-3-yl)-6-methyl-11-methylidene-3-propan-2-yl-1-oxa-4,7,12-triazacyclotetradec-9-ene-2,5,8,13-tetrone |
|---|---|
| PubChem CID | 139583249 |
| Molecular Formula | C26H43N3O6 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.32 |
| IUPAC Name | (3R,6S,9E)-14-(1-hydroxy-4-methyldecan-3-yl)-6-methyl-11-methylidene-3-propan-2-yl-1-oxa-4,7,12-triazacyclotetradec-9-ene-2,5,8,13-tetrone |
| SMILES | C=C1/C=C/C(=O)N[C@@H](C)C(=O)N[C@H](C(C)C)C(=O)OC(C(CCO)C(C)CCCCCC)C(=O)N1 |
| InChI | InChI=1S/C26H43N3O6/c1-7-8-9-10-11-17(4)20(14-15-30)23-25(33)27-18(5)12-13-21(31)28-19(6)24(32)29-22(16(2)3)26(34)35-23/h12-13,16-17,19-20,22-23,30H,5,7-11,14-15H2,1-4,6H3,(H,27,33)(H,28,31)(H,29,32)/b13-12+/t17?,19-,20?,22+,23?/m0/s1 |
| InChIKey | QWBWNXCMGNCVQC-OIXFFAKGSA-N |
| XLogP | 2.35 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|