C19H30O6 — CID 139583416
(4R,5R,6R,7R,10R)-10-[(E,3R,5R)-3,5-dimethylhept-1-enyl]-3,4,6,7-tetrahydroxy-3-methyl-2-oxaspiro[4.5]dec-8-en-1-one (PubChem CID 139583416) has the molecular formula C19H30O6 and a molecular weight of 354.44 g/mol. Its IUPAC name is (4R,5R,6R,7R,10R)-10-[(E,3R,5R)-3,5-dimethylhept-1-enyl]-3,4,6,7-tetrahydroxy-3-methyl-2-oxaspiro[4.5]dec-8-en-1-one.
| Compound Name | (4R,5R,6R,7R,10R)-10-[(E,3R,5R)-3,5-dimethylhept-1-enyl]-3,4,6,7-tetrahydroxy-3-methyl-2-oxaspiro[4.5]dec-8-en-1-one |
|---|---|
| PubChem CID | 139583416 |
| Molecular Formula | C19H30O6 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | (4R,5R,6R,7R,10R)-10-[(E,3R,5R)-3,5-dimethylhept-1-enyl]-3,4,6,7-tetrahydroxy-3-methyl-2-oxaspiro[4.5]dec-8-en-1-one |
| SMILES | CC[C@@H](C)C[C@@H](C)/C=C/[C@@H]1C=C[C@@H](O)[C@H](O)[C@]12C(=O)OC(C)(O)[C@@H]2O |
| InChI | InChI=1S/C19H30O6/c1-5-11(2)10-12(3)6-7-13-8-9-14(20)15(21)19(13)16(22)18(4,24)25-17(19)23/h6-9,11-16,20-22,24H,5,10H2,1-4H3/b7-6+/t11-,12+,13-,14-,15+,16+,18?,19-/m1/s1 |
| InChIKey | YREGLMQCOGERBX-PNBHOSHPSA-N |
| XLogP | 1.14 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|