C18H30O5 — CID 139583469
(3aS,5R,5'R,6aS)-5'-[(5S)-5-hydroxyheptyl]-3,3-dimethylspiro[6,6a-dihydro-3aH-furo[3,2-b]furan-5,2'-oxolane]-2-one (PubChem CID 139583469) has the molecular formula C18H30O5 and a molecular weight of 326.43 g/mol. Its IUPAC name is (3aS,5R,5'R,6aS)-5'-[(5S)-5-hydroxyheptyl]-3,3-dimethylspiro[6,6a-dihydro-3aH-furo[3,2-b]furan-5,2'-oxolane]-2-one.
| Compound Name | (3aS,5R,5'R,6aS)-5'-[(5S)-5-hydroxyheptyl]-3,3-dimethylspiro[6,6a-dihydro-3aH-furo[3,2-b]furan-5,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 139583469 |
| Molecular Formula | C18H30O5 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | (3aS,5R,5'R,6aS)-5'-[(5S)-5-hydroxyheptyl]-3,3-dimethylspiro[6,6a-dihydro-3aH-furo[3,2-b]furan-5,2'-oxolane]-2-one |
| SMILES | CC[C@H](O)CCCC[C@@H]1CC[C@@]2(C[C@@H]3OC(=O)C(C)(C)[C@@H]3O2)O1 |
| InChI | InChI=1S/C18H30O5/c1-4-12(19)7-5-6-8-13-9-10-18(22-13)11-14-15(23-18)17(2,3)16(20)21-14/h12-15,19H,4-11H2,1-3H3/t12-,13+,14-,15+,18+/m0/s1 |
| InChIKey | BJYDMDQYCGNRKX-CGSPGFDNSA-N |
| XLogP | 2.93 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|