C14H22O5 — CID 139583529
(4aS,5R,8S,8aR)-8-hydroxy-8-(hydroxymethyl)-5-propan-2-yl-2,4a,5,6,7,8a-hexahydrochromene-3-carboxylic acid (PubChem CID 139583529) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is (4aS,5R,8S,8aR)-8-hydroxy-8-(hydroxymethyl)-5-propan-2-yl-2,4a,5,6,7,8a-hexahydrochromene-3-carboxylic acid.
| Compound Name | (4aS,5R,8S,8aR)-8-hydroxy-8-(hydroxymethyl)-5-propan-2-yl-2,4a,5,6,7,8a-hexahydrochromene-3-carboxylic acid |
|---|---|
| PubChem CID | 139583529 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | (4aS,5R,8S,8aR)-8-hydroxy-8-(hydroxymethyl)-5-propan-2-yl-2,4a,5,6,7,8a-hexahydrochromene-3-carboxylic acid |
| SMILES | CC(C)[C@H]1CC[C@](O)(CO)[C@@H]2OCC(C(=O)O)=C[C@H]12 |
| InChI | InChI=1S/C14H22O5/c1-8(2)10-3-4-14(18,7-15)12-11(10)5-9(6-19-12)13(16)17/h5,8,10-12,15,18H,3-4,6-7H2,1-2H3,(H,16,17)/t10-,11-,12-,14+/m1/s1 |
| InChIKey | PIOOXQKLTYQUAP-BYNQJWBRSA-N |
| XLogP | 0.80 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |