About (4R,6S)-6-methyl-4-[(1R,5S)-5-methyl-4-oxocyclohex-2-en-1-yl]oxycyclohex-2-en-1-one
(4R,6S)-6-methyl-4-[(1R,5S)-5-methyl-4-oxocyclohex-2-en-1-yl]oxycyclohex-2-en-1-one (PubChem CID 139583546) has the molecular formula C14H18O3
and a molecular weight of 234.29 g/mol. Its IUPAC name is (4R,6S)-6-methyl-4-[(1R,5S)-5-methyl-4-oxocyclohex-2-en-1-yl]oxycyclohex-2-en-1-one.
Molecular Properties
| Compound Name | (4R,6S)-6-methyl-4-[(1R,5S)-5-methyl-4-oxocyclohex-2-en-1-yl]oxycyclohex-2-en-1-one |
| PubChem CID | 139583546 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (4R,6S)-6-methyl-4-[(1R,5S)-5-methyl-4-oxocyclohex-2-en-1-yl]oxycyclohex-2-en-1-one |
| SMILES | C[C@H]1C[C@@H](O[C@H]2C=CC(=O)[C@@H](C)C2)C=CC1=O |
| InChI | InChI=1S/C14H18O3/c1-9-7-11(3-5-13(9)15)17-12-4-6-14(16)10(2)8-12/h3-6,9-12H,7-8H2,1-2H3/t9-,10-,11-,12-/m0/s1 |
| InChIKey | AJRXCMFONRLPJH-BJDJZHNGSA-N |
| XLogP | 2.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R,6S)-6-methyl-4-[(1R,5S)-5-methyl-4-oxocyclohex-2-en-1-yl]oxycyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,6S)-6-methyl-4-[(1R,5S)-5-methyl-4-oxocyclohex-2-en-1-yl]oxycyclohex-2-en-1-one?
The IUPAC name of (4R,6S)-6-methyl-4-[(1R,5S)-5-methyl-4-oxocyclohex-2-en-1-yl]oxycyclohex-2-en-1-one (CID 139583546) is (4R,6S)-6-methyl-4-[(1R,5S)-5-methyl-4-oxocyclohex-2-en-1-yl]oxycyclohex-2-en-1-one.
What is the SMILES notation for (4R,6S)-6-methyl-4-[(1R,5S)-5-methyl-4-oxocyclohex-2-en-1-yl]oxycyclohex-2-en-1-one?
The canonical SMILES for (4R,6S)-6-methyl-4-[(1R,5S)-5-methyl-4-oxocyclohex-2-en-1-yl]oxycyclohex-2-en-1-one is C[C@H]1C[C@@H](O[C@H]2C=CC(=O)[C@@H](C)C2)C=CC1=O.
What is the InChIKey of (4R,6S)-6-methyl-4-[(1R,5S)-5-methyl-4-oxocyclohex-2-en-1-yl]oxycyclohex-2-en-1-one?
The InChIKey is AJRXCMFONRLPJH-BJDJZHNGSA-N. The full InChI is InChI=1S/C14H18O3/c1-9-7-11(3-5-13(9)15)17-12-4-6-14(16)10(2)8-12/h3-6,9-12H,7-8H2,1-2H3/t9-,10-,11-,12-/m0/s1.
What are the key properties of (4R,6S)-6-methyl-4-[(1R,5S)-5-methyl-4-oxocyclohex-2-en-1-yl]oxycyclohex-2-en-1-one?
(4R,6S)-6-methyl-4-[(1R,5S)-5-methyl-4-oxocyclohex-2-en-1-yl]oxycyclohex-2-en-1-one has a molecular weight of 234.29 g/mol, XLogP of 2.07, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,6S)-6-methyl-4-[(1R,5S)-5-methyl-4-oxocyclohex-2-en-1-yl]oxycyclohex-2-en-1-one is sourced from PubChem (CID 139583546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).