C17H28O7 — CID 139583592
[(2R,5S)-5-hydroxy-8-methoxy-8-oxooct-6-en-2-yl] (4S,7R)-4,7-dihydroxyoct-2-enoate (PubChem CID 139583592) has the molecular formula C17H28O7 and a molecular weight of 344.40 g/mol. Its IUPAC name is [(2R,5S)-5-hydroxy-8-methoxy-8-oxooct-6-en-2-yl] (4S,7R)-4,7-dihydroxyoct-2-enoate.
| Compound Name | [(2R,5S)-5-hydroxy-8-methoxy-8-oxooct-6-en-2-yl] (4S,7R)-4,7-dihydroxyoct-2-enoate |
|---|---|
| PubChem CID | 139583592 |
| Molecular Formula | C17H28O7 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | [(2R,5S)-5-hydroxy-8-methoxy-8-oxooct-6-en-2-yl] (4S,7R)-4,7-dihydroxyoct-2-enoate |
| SMILES | COC(=O)C=C[C@@H](O)CC[C@@H](C)OC(=O)C=C[C@@H](O)CC[C@@H](C)O |
| InChI | InChI=1S/C17H28O7/c1-12(18)4-6-14(19)9-11-17(22)24-13(2)5-7-15(20)8-10-16(21)23-3/h8-15,18-20H,4-7H2,1-3H3/t12-,13-,14+,15+/m1/s1 |
| InChIKey | VEDYDEVHOOQRCN-KBXIAJHMSA-N |
| XLogP | 0.87 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|