C26H46O8 — CID 139583622
[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (4E,12E)-14-hydroxyicosa-4,12-dienoate (PubChem CID 139583622) has the molecular formula C26H46O8 and a molecular weight of 486.65 g/mol. Its IUPAC name is [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (4E,12E)-14-hydroxyicosa-4,12-dienoate.
| Compound Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (4E,12E)-14-hydroxyicosa-4,12-dienoate |
|---|---|
| PubChem CID | 139583622 |
| Molecular Formula | C26H46O8 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (4E,12E)-14-hydroxyicosa-4,12-dienoate |
| SMILES | CCCCCCC(O)/C=C/CCCCCC/C=C/CCC(=O)OC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C26H46O8/c1-2-3-4-13-16-20(28)17-14-11-9-7-5-6-8-10-12-15-18-22(29)34-26-25(32)24(31)23(30)21(19-27)33-26/h10,12,14,17,20-21,23-28,30-32H,2-9,11,13,15-16,18-19H2,1H3/b12-10+,17-14+ |
| InChIKey | IQKISTNYFDXAGD-XSJNGTIOSA-N |
| XLogP | 2.89 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|