C11H22O3 — CID 139583645
(3R,4S,5S,6S)-2,6-diethyl-3,5-dimethyloxane-2,4-diol (PubChem CID 139583645) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is (3R,4S,5S,6S)-2,6-diethyl-3,5-dimethyloxane-2,4-diol.
| Compound Name | (3R,4S,5S,6S)-2,6-diethyl-3,5-dimethyloxane-2,4-diol |
|---|---|
| PubChem CID | 139583645 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | (3R,4S,5S,6S)-2,6-diethyl-3,5-dimethyloxane-2,4-diol |
| SMILES | CC[C@@H]1OC(O)(CC)[C@H](C)[C@@H](O)[C@@H]1C |
| InChI | InChI=1S/C11H22O3/c1-5-9-7(3)10(12)8(4)11(13,6-2)14-9/h7-10,12-13H,5-6H2,1-4H3/t7-,8-,9+,10+,11?/m1/s1 |
| InChIKey | QDJKQVLUTJJLAC-XSIKWTSOSA-N |
| XLogP | 1.53 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |