C15H22O2 — CID 139583666
(3aR,3bS,6aS,7S,7aS)-7-hydroxy-3,5,5,7a-tetramethyl-3a,3b,4,6,6a,7-hexahydrocyclopenta[a]pentalen-1-one (PubChem CID 139583666) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (3aR,3bS,6aS,7S,7aS)-7-hydroxy-3,5,5,7a-tetramethyl-3a,3b,4,6,6a,7-hexahydrocyclopenta[a]pentalen-1-one.
| Compound Name | (3aR,3bS,6aS,7S,7aS)-7-hydroxy-3,5,5,7a-tetramethyl-3a,3b,4,6,6a,7-hexahydrocyclopenta[a]pentalen-1-one |
|---|---|
| PubChem CID | 139583666 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (3aR,3bS,6aS,7S,7aS)-7-hydroxy-3,5,5,7a-tetramethyl-3a,3b,4,6,6a,7-hexahydrocyclopenta[a]pentalen-1-one |
| SMILES | CC1=CC(=O)[C@]2(C)[C@@H](O)[C@H]3CC(C)(C)C[C@H]3[C@H]12 |
| InChI | InChI=1S/C15H22O2/c1-8-5-11(16)15(4)12(8)9-6-14(2,3)7-10(9)13(15)17/h5,9-10,12-13,17H,6-7H2,1-4H3/t9-,10+,12+,13+,15+/m1/s1 |
| InChIKey | XKOIZSBVTCBENR-UXJQQSFASA-N |
| XLogP | 2.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |