C11H18O4 — CID 139583738
(1R,4S,6R)-4-methoxy-4-pentyl-3,7-dioxabicyclo[4.1.0]heptan-2-one (PubChem CID 139583738) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is (1R,4S,6R)-4-methoxy-4-pentyl-3,7-dioxabicyclo[4.1.0]heptan-2-one.
| Compound Name | (1R,4S,6R)-4-methoxy-4-pentyl-3,7-dioxabicyclo[4.1.0]heptan-2-one |
|---|---|
| PubChem CID | 139583738 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (1R,4S,6R)-4-methoxy-4-pentyl-3,7-dioxabicyclo[4.1.0]heptan-2-one |
| SMILES | CCCCC[C@@]1(OC)C[C@H]2O[C@H]2C(=O)O1 |
| InChI | InChI=1S/C11H18O4/c1-3-4-5-6-11(13-2)7-8-9(14-8)10(12)15-11/h8-9H,3-7H2,1-2H3/t8-,9-,11+/m1/s1 |
| InChIKey | NINCXQRSQVSCLG-KKZNHRDASA-N |
| XLogP | 1.62 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|