C15H28O4 — CID 139583816
(1R,2S,3aR,4R,7R,8aS)-7-(1,2-dihydroxypropan-2-yl)-1,4-dimethyl-2,3,3a,5,6,7,8,8a-octahydro-1H-azulene-2,4-diol (PubChem CID 139583816) has the molecular formula C15H28O4 and a molecular weight of 272.38 g/mol. Its IUPAC name is (1R,2S,3aR,4R,7R,8aS)-7-(1,2-dihydroxypropan-2-yl)-1,4-dimethyl-2,3,3a,5,6,7,8,8a-octahydro-1H-azulene-2,4-diol.
| Compound Name | (1R,2S,3aR,4R,7R,8aS)-7-(1,2-dihydroxypropan-2-yl)-1,4-dimethyl-2,3,3a,5,6,7,8,8a-octahydro-1H-azulene-2,4-diol |
|---|---|
| PubChem CID | 139583816 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | (1R,2S,3aR,4R,7R,8aS)-7-(1,2-dihydroxypropan-2-yl)-1,4-dimethyl-2,3,3a,5,6,7,8,8a-octahydro-1H-azulene-2,4-diol |
| SMILES | C[C@@H]1[C@@H]2C[C@H](C(C)(O)CO)CC[C@@](C)(O)[C@@H]2C[C@@H]1O |
| InChI | InChI=1S/C15H28O4/c1-9-11-6-10(15(3,19)8-16)4-5-14(2,18)12(11)7-13(9)17/h9-13,16-19H,4-8H2,1-3H3/t9-,10-,11+,12-,13+,14-,15?/m1/s1 |
| InChIKey | WTIPTDQVDAVYRV-QAJRHMJVSA-N |
| XLogP | 0.91 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |