C33H54O3 — CID 139583818
(2,5,5,8a-tetramethyl-4-oxo-4a,6,7,8-tetrahydro-1H-naphthalen-1-yl)methyl octadeca-9,12-dienoate (PubChem CID 139583818) has the molecular formula C33H54O3 and a molecular weight of 498.79 g/mol. Its IUPAC name is (2,5,5,8a-tetramethyl-4-oxo-4a,6,7,8-tetrahydro-1H-naphthalen-1-yl)methyl octadeca-9,12-dienoate.
| Compound Name | (2,5,5,8a-tetramethyl-4-oxo-4a,6,7,8-tetrahydro-1H-naphthalen-1-yl)methyl octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 139583818 |
| Molecular Formula | C33H54O3 |
| Molecular Weight | 498.79 g/mol |
| Exact Mass | 498.41 |
| IUPAC Name | (2,5,5,8a-tetramethyl-4-oxo-4a,6,7,8-tetrahydro-1H-naphthalen-1-yl)methyl octadeca-9,12-dienoate |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)OCC1C(C)=CC(=O)C2C(C)(C)CCCC12C |
| InChI | InChI=1S/C33H54O3/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-30(35)36-26-28-27(2)25-29(34)31-32(3,4)23-21-24-33(28,31)5/h10-11,13-14,25,28,31H,6-9,12,15-24,26H2,1-5H3 |
| InChIKey | AVYWKEFVEJDTNB-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.79 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|