C30H52O6 — CID 139583850
(3E,5E,15E)-8,10,12-trihydroxy-20-(4-hydroxyhexyl)-11,13,15,17,19-pentamethyl-1-oxacycloicosa-3,5,15-trien-2-one (PubChem CID 139583850) has the molecular formula C30H52O6 and a molecular weight of 508.74 g/mol. Its IUPAC name is (3E,5E,15E)-8,10,12-trihydroxy-20-(4-hydroxyhexyl)-11,13,15,17,19-pentamethyl-1-oxacycloicosa-3,5,15-trien-2-one.
| Compound Name | (3E,5E,15E)-8,10,12-trihydroxy-20-(4-hydroxyhexyl)-11,13,15,17,19-pentamethyl-1-oxacycloicosa-3,5,15-trien-2-one |
|---|---|
| PubChem CID | 139583850 |
| Molecular Formula | C30H52O6 |
| Molecular Weight | 508.74 g/mol |
| Exact Mass | 508.38 |
| IUPAC Name | (3E,5E,15E)-8,10,12-trihydroxy-20-(4-hydroxyhexyl)-11,13,15,17,19-pentamethyl-1-oxacycloicosa-3,5,15-trien-2-one |
| SMILES | CCC(O)CCCC1OC(=O)/C=C/C=C/CC(O)CC(O)C(C)C(O)C(C)C/C(C)=C/C(C)CC1C |
| InChI | InChI=1S/C30H52O6/c1-7-25(31)13-11-14-28-22(4)17-20(2)16-21(3)18-23(5)30(35)24(6)27(33)19-26(32)12-9-8-10-15-29(34)36-28/h8-10,15-16,20,22-28,30-33,35H,7,11-14,17-19H2,1-6H3/b9-8+,15-10+,21-16+ |
| InChIKey | PYWGGTVYWYWKTF-YYCHHVQGSA-N |
| XLogP | 5.10 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.74 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|