C22H36O6 — CID 139583904
(1R,2R,5R,7R,10S,14S,16S)-5,14-diethyl-2,11-dimethyl-4,13,19,20-tetraoxatricyclo[14.2.1.17,10]icosane-3,12-dione (PubChem CID 139583904) has the molecular formula C22H36O6 and a molecular weight of 396.52 g/mol. Its IUPAC name is (1R,2R,5R,7R,10S,14S,16S)-5,14-diethyl-2,11-dimethyl-4,13,19,20-tetraoxatricyclo[14.2.1.17,10]icosane-3,12-dione.
| Compound Name | (1R,2R,5R,7R,10S,14S,16S)-5,14-diethyl-2,11-dimethyl-4,13,19,20-tetraoxatricyclo[14.2.1.17,10]icosane-3,12-dione |
|---|---|
| PubChem CID | 139583904 |
| Molecular Formula | C22H36O6 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | (1R,2R,5R,7R,10S,14S,16S)-5,14-diethyl-2,11-dimethyl-4,13,19,20-tetraoxatricyclo[14.2.1.17,10]icosane-3,12-dione |
| SMILES | CC[C@H]1C[C@@H]2CC[C@@H](O2)[C@@H](C)C(=O)O[C@H](CC)C[C@H]2CC[C@H](O2)C(C)C(=O)O1 |
| InChI | InChI=1S/C22H36O6/c1-5-15-11-17-7-9-20(25-17)14(4)22(24)28-16(6-2)12-18-8-10-19(26-18)13(3)21(23)27-15/h13-20H,5-12H2,1-4H3/t13-,14?,15-,16+,17-,18+,19-,20+/m1/s1 |
| InChIKey | VYGSEJPMQXVTNW-UPOFUFPUSA-N |
| XLogP | 3.79 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |