About (2R)-4-[(1R,2S)-1,2-dihydroxypropyl]-2-[(1S)-1-hydroxyethyl]-2H-furan-5-one
(2R)-4-[(1R,2S)-1,2-dihydroxypropyl]-2-[(1S)-1-hydroxyethyl]-2H-furan-5-one (PubChem CID 139584013) has the molecular formula C9H14O5
and a molecular weight of 202.21 g/mol. Its IUPAC name is (2R)-4-[(1R,2S)-1,2-dihydroxypropyl]-2-[(1S)-1-hydroxyethyl]-2H-furan-5-one.
Molecular Properties
| Compound Name | (2R)-4-[(1R,2S)-1,2-dihydroxypropyl]-2-[(1S)-1-hydroxyethyl]-2H-furan-5-one |
| PubChem CID | 139584013 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | (2R)-4-[(1R,2S)-1,2-dihydroxypropyl]-2-[(1S)-1-hydroxyethyl]-2H-furan-5-one |
| SMILES | C[C@H](O)[C@H](O)C1=C[C@H]([C@H](C)O)OC1=O |
| InChI | InChI=1S/C9H14O5/c1-4(10)7-3-6(9(13)14-7)8(12)5(2)11/h3-5,7-8,10-12H,1-2H3/t4-,5-,7+,8-/m0/s1 |
| InChIKey | ARUCEWIJCNEASJ-MGVQOFIGSA-N |
| XLogP | -1.04 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-4-[(1R,2S)-1,2-dihydroxypropyl]-2-[(1S)-1-hydroxyethyl]-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4-[(1R,2S)-1,2-dihydroxypropyl]-2-[(1S)-1-hydroxyethyl]-2H-furan-5-one?
The IUPAC name of (2R)-4-[(1R,2S)-1,2-dihydroxypropyl]-2-[(1S)-1-hydroxyethyl]-2H-furan-5-one (CID 139584013) is (2R)-4-[(1R,2S)-1,2-dihydroxypropyl]-2-[(1S)-1-hydroxyethyl]-2H-furan-5-one.
What is the SMILES notation for (2R)-4-[(1R,2S)-1,2-dihydroxypropyl]-2-[(1S)-1-hydroxyethyl]-2H-furan-5-one?
The canonical SMILES for (2R)-4-[(1R,2S)-1,2-dihydroxypropyl]-2-[(1S)-1-hydroxyethyl]-2H-furan-5-one is C[C@H](O)[C@H](O)C1=C[C@H]([C@H](C)O)OC1=O.
What is the InChIKey of (2R)-4-[(1R,2S)-1,2-dihydroxypropyl]-2-[(1S)-1-hydroxyethyl]-2H-furan-5-one?
The InChIKey is ARUCEWIJCNEASJ-MGVQOFIGSA-N. The full InChI is InChI=1S/C9H14O5/c1-4(10)7-3-6(9(13)14-7)8(12)5(2)11/h3-5,7-8,10-12H,1-2H3/t4-,5-,7+,8-/m0/s1.
What are the key properties of (2R)-4-[(1R,2S)-1,2-dihydroxypropyl]-2-[(1S)-1-hydroxyethyl]-2H-furan-5-one?
(2R)-4-[(1R,2S)-1,2-dihydroxypropyl]-2-[(1S)-1-hydroxyethyl]-2H-furan-5-one has a molecular weight of 202.21 g/mol, XLogP of -1.04, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4-[(1R,2S)-1,2-dihydroxypropyl]-2-[(1S)-1-hydroxyethyl]-2H-furan-5-one is sourced from PubChem (CID 139584013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).