C15H24O2 — CID 139584038
(1'R,3S,3aR,6S,7R,7aS)-2',3,6-trimethylspiro[3,3a,4,5,6,7a-hexahydro-2H-1-benzofuran-7,4'-cyclopent-2-ene]-1'-ol (PubChem CID 139584038) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (1'R,3S,3aR,6S,7R,7aS)-2',3,6-trimethylspiro[3,3a,4,5,6,7a-hexahydro-2H-1-benzofuran-7,4'-cyclopent-2-ene]-1'-ol.
| Compound Name | (1'R,3S,3aR,6S,7R,7aS)-2',3,6-trimethylspiro[3,3a,4,5,6,7a-hexahydro-2H-1-benzofuran-7,4'-cyclopent-2-ene]-1'-ol |
|---|---|
| PubChem CID | 139584038 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (1'R,3S,3aR,6S,7R,7aS)-2',3,6-trimethylspiro[3,3a,4,5,6,7a-hexahydro-2H-1-benzofuran-7,4'-cyclopent-2-ene]-1'-ol |
| SMILES | CC1=C[C@@]2(C[C@H]1O)[C@@H](C)CC[C@@H]1[C@H](C)CO[C@@H]12 |
| InChI | InChI=1S/C15H24O2/c1-9-6-15(7-13(9)16)11(3)4-5-12-10(2)8-17-14(12)15/h6,10-14,16H,4-5,7-8H2,1-3H3/t10-,11+,12-,13-,14+,15-/m1/s1 |
| InChIKey | IAEABCWVVYXBSR-ZAQNNHEOSA-N |
| XLogP | 2.76 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|