C21H25NO4 — CID 139584240
(6S,6aR,8S,9R,10R,10aR)-9-hydroxy-4-(4-hydroxyphenyl)-6,8,10-trimethyl-2,6,6a,7,8,9,10,10a-octahydroisochromeno[4,3-c]pyridin-1-one (PubChem CID 139584240) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is (6S,6aR,8S,9R,10R,10aR)-9-hydroxy-4-(4-hydroxyphenyl)-6,8,10-trimethyl-2,6,6a,7,8,9,10,10a-octahydroisochromeno[4,3-c]pyridin-1-one.
| Compound Name | (6S,6aR,8S,9R,10R,10aR)-9-hydroxy-4-(4-hydroxyphenyl)-6,8,10-trimethyl-2,6,6a,7,8,9,10,10a-octahydroisochromeno[4,3-c]pyridin-1-one |
|---|---|
| PubChem CID | 139584240 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | (6S,6aR,8S,9R,10R,10aR)-9-hydroxy-4-(4-hydroxyphenyl)-6,8,10-trimethyl-2,6,6a,7,8,9,10,10a-octahydroisochromeno[4,3-c]pyridin-1-one |
| SMILES | C[C@H]1[C@H](O)[C@@H](C)C[C@@H]2[C@@H]1c1c(c(-c3ccc(O)cc3)c[nH]c1=O)O[C@H]2C |
| InChI | InChI=1S/C21H25NO4/c1-10-8-15-12(3)26-20-16(13-4-6-14(23)7-5-13)9-22-21(25)18(20)17(15)11(2)19(10)24/h4-7,9-12,15,17,19,23-24H,8H2,1-3H3,(H,22,25)/t10-,11+,12-,15-,17+,19+/m0/s1 |
| InChIKey | AUGZUCOCYQVSPC-PIHMXPPNSA-N |
| XLogP | 3.27 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |