C10H14O6 — CID 139584261
1-[(2R,3S,3aR,6aR)-3-hydroxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-2-yl]ethyl acetate (PubChem CID 139584261) has the molecular formula C10H14O6 and a molecular weight of 230.22 g/mol. Its IUPAC name is 1-[(2R,3S,3aR,6aR)-3-hydroxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-2-yl]ethyl acetate.
| Compound Name | 1-[(2R,3S,3aR,6aR)-3-hydroxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-2-yl]ethyl acetate |
|---|---|
| PubChem CID | 139584261 |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 1-[(2R,3S,3aR,6aR)-3-hydroxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-2-yl]ethyl acetate |
| SMILES | CC(=O)OC(C)[C@@H]1O[C@@H]2CC(=O)O[C@@H]2[C@H]1O |
| InChI | InChI=1S/C10H14O6/c1-4(14-5(2)11)9-8(13)10-6(15-9)3-7(12)16-10/h4,6,8-10,13H,3H2,1-2H3/t4?,6-,8+,9+,10+/m1/s1 |
| InChIKey | WUHFOIPFQKEGNR-VEDATXIZSA-N |
| XLogP | -0.62 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |