C15H26O4 — CID 139584324
6-[(1S,3S,4R)-3,4-dihydroxy-4-methylcyclohexyl]-2-methylhept-5-enoic acid (PubChem CID 139584324) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is 6-[(1S,3S,4R)-3,4-dihydroxy-4-methylcyclohexyl]-2-methylhept-5-enoic acid.
| Compound Name | 6-[(1S,3S,4R)-3,4-dihydroxy-4-methylcyclohexyl]-2-methylhept-5-enoic acid |
|---|---|
| PubChem CID | 139584324 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 6-[(1S,3S,4R)-3,4-dihydroxy-4-methylcyclohexyl]-2-methylhept-5-enoic acid |
| SMILES | CC(=CCCC(C)C(=O)O)[C@H]1CC[C@@](C)(O)[C@@H](O)C1 |
| InChI | InChI=1S/C15H26O4/c1-10(5-4-6-11(2)14(17)18)12-7-8-15(3,19)13(16)9-12/h5,11-13,16,19H,4,6-9H2,1-3H3,(H,17,18)/t11?,12-,13-,15+/m0/s1 |
| InChIKey | AOEJTISCDPEQDI-ZBVJJQAHSA-N |
| XLogP | 2.35 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|