C22H32O4 — CID 139584368
(1R,3S,4S,6R,10R,13R,15R)-13-ethyl-4,6,10,12-tetramethyl-2,16-dioxatetracyclo[13.2.1.01,3.010,15]octadec-11-ene-17,18-dione (PubChem CID 139584368) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is (1R,3S,4S,6R,10R,13R,15R)-13-ethyl-4,6,10,12-tetramethyl-2,16-dioxatetracyclo[13.2.1.01,3.010,15]octadec-11-ene-17,18-dione.
| Compound Name | (1R,3S,4S,6R,10R,13R,15R)-13-ethyl-4,6,10,12-tetramethyl-2,16-dioxatetracyclo[13.2.1.01,3.010,15]octadec-11-ene-17,18-dione |
|---|---|
| PubChem CID | 139584368 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (1R,3S,4S,6R,10R,13R,15R)-13-ethyl-4,6,10,12-tetramethyl-2,16-dioxatetracyclo[13.2.1.01,3.010,15]octadec-11-ene-17,18-dione |
| SMILES | CC[C@@H]1C[C@@]23OC(=O)[C@]4(O[C@H]4[C@@H](C)C[C@H](C)CCC[C@]2(C)C=C1C)C3=O |
| InChI | InChI=1S/C22H32O4/c1-6-16-12-21-18(23)22(19(24)26-21)17(25-22)14(3)10-13(2)8-7-9-20(21,5)11-15(16)4/h11,13-14,16-17H,6-10,12H2,1-5H3/t13-,14+,16-,17+,20-,21+,22-/m1/s1 |
| InChIKey | RRVPBWBDQBVHHW-IZIWQKFHSA-N |
| XLogP | 4.22 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|