C12H16O4 — CID 139584408
(4R,5R,6R)-6-hydroxy-5-(1-hydroxy-2-oxopropyl)-4-[(E)-prop-1-enyl]cyclohex-2-en-1-one (PubChem CID 139584408) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (4R,5R,6R)-6-hydroxy-5-(1-hydroxy-2-oxopropyl)-4-[(E)-prop-1-enyl]cyclohex-2-en-1-one.
| Compound Name | (4R,5R,6R)-6-hydroxy-5-(1-hydroxy-2-oxopropyl)-4-[(E)-prop-1-enyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 139584408 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (4R,5R,6R)-6-hydroxy-5-(1-hydroxy-2-oxopropyl)-4-[(E)-prop-1-enyl]cyclohex-2-en-1-one |
| SMILES | C/C=C/[C@@H]1C=CC(=O)[C@H](O)[C@H]1C(O)C(C)=O |
| InChI | InChI=1S/C12H16O4/c1-3-4-8-5-6-9(14)12(16)10(8)11(15)7(2)13/h3-6,8,10-12,15-16H,1-2H3/b4-3+/t8-,10-,11?,12+/m1/s1 |
| InChIKey | SSXSKRMBIBHWCM-IEUJGMFCSA-N |
| XLogP | 0.24 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|