C31H46O10 — CID 139584513
(17Z)-21-ethyl-9,11,16-trihydroxy-13-methoxy-10,12,16,18,24-pentamethyl-2,22,26-trioxatricyclo[19.3.1.15,8]hexacosa-5,17,19-triene-3,7,23-trione (PubChem CID 139584513) has the molecular formula C31H46O10 and a molecular weight of 578.70 g/mol. Its IUPAC name is (17Z)-21-ethyl-9,11,16-trihydroxy-13-methoxy-10,12,16,18,24-pentamethyl-2,22,26-trioxatricyclo[19.3.1.15,8]hexacosa-5,17,19-triene-3,7,23-trione.
| Compound Name | (17Z)-21-ethyl-9,11,16-trihydroxy-13-methoxy-10,12,16,18,24-pentamethyl-2,22,26-trioxatricyclo[19.3.1.15,8]hexacosa-5,17,19-triene-3,7,23-trione |
|---|---|
| PubChem CID | 139584513 |
| Molecular Formula | C31H46O10 |
| Molecular Weight | 578.70 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | (17Z)-21-ethyl-9,11,16-trihydroxy-13-methoxy-10,12,16,18,24-pentamethyl-2,22,26-trioxatricyclo[19.3.1.15,8]hexacosa-5,17,19-triene-3,7,23-trione |
| SMILES | CCC12C=C/C(C)=C\C(C)(O)CCC(OC)C(C)C(O)C(C)C(O)C3OC(=CC3=O)CC(=O)OC(C1)C(C)C(=O)O2 |
| InChI | InChI=1S/C31H46O10/c1-8-31-12-9-17(2)15-30(6,37)11-10-23(38-7)18(3)26(34)20(5)27(35)28-22(32)13-21(39-28)14-25(33)40-24(16-31)19(4)29(36)41-31/h9,12-13,15,18-20,23-24,26-28,34-35,37H,8,10-11,14,16H2,1-7H3/b12-9?,17-15- |
| InChIKey | VCPZJAICYPAPCG-SHDBNYCTSA-N |
| XLogP | 2.93 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.70 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |