C15H16O4 — CID 139584521
(1S,8R,11R,15S)-5,5-dimethyl-10,12-dioxapentacyclo[6.5.2.01,15.03,7.011,15]pentadec-3(7)-ene-6,13-dione (PubChem CID 139584521) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is (1S,8R,11R,15S)-5,5-dimethyl-10,12-dioxapentacyclo[6.5.2.01,15.03,7.011,15]pentadec-3(7)-ene-6,13-dione.
| Compound Name | (1S,8R,11R,15S)-5,5-dimethyl-10,12-dioxapentacyclo[6.5.2.01,15.03,7.011,15]pentadec-3(7)-ene-6,13-dione |
|---|---|
| PubChem CID | 139584521 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (1S,8R,11R,15S)-5,5-dimethyl-10,12-dioxapentacyclo[6.5.2.01,15.03,7.011,15]pentadec-3(7)-ene-6,13-dione |
| SMILES | CC1(C)CC2=C(C1=O)[C@@H]1CO[C@@H]3OC(=O)[C@@]4(C2)C[C@]314 |
| InChI | InChI=1S/C15H16O4/c1-13(2)3-7-4-14-6-15(14)8(9(7)10(13)16)5-18-12(15)19-11(14)17/h8,12H,3-6H2,1-2H3/t8-,12+,14+,15+/m0/s1 |
| InChIKey | FOUVOYMRQALSDO-AZEZGGBOSA-N |
| XLogP | 1.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |