C14H18O6 — CID 139584579
[(2R,3S,4Z,7S)-7-hydroxy-2-methyl-6,10-dioxo-3,7,8,9-tetrahydro-2H-oxecin-3-yl] (E)-but-2-enoate (PubChem CID 139584579) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is [(2R,3S,4Z,7S)-7-hydroxy-2-methyl-6,10-dioxo-3,7,8,9-tetrahydro-2H-oxecin-3-yl] (E)-but-2-enoate.
| Compound Name | [(2R,3S,4Z,7S)-7-hydroxy-2-methyl-6,10-dioxo-3,7,8,9-tetrahydro-2H-oxecin-3-yl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 139584579 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | [(2R,3S,4Z,7S)-7-hydroxy-2-methyl-6,10-dioxo-3,7,8,9-tetrahydro-2H-oxecin-3-yl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)O[C@H]1/C=C\C(=O)[C@@H](O)CCC(=O)O[C@@H]1C |
| InChI | InChI=1S/C14H18O6/c1-3-4-13(17)20-12-7-5-10(15)11(16)6-8-14(18)19-9(12)2/h3-5,7,9,11-12,16H,6,8H2,1-2H3/b4-3+,7-5-/t9-,11+,12+/m1/s1 |
| InChIKey | GKYMOCGFYKKSSG-YSPKNVJVSA-N |
| XLogP | 0.69 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|