C15H26O6 — CID 139584678
(E)-4,5,6-trihydroxy-6-[4-(hydroxymethyl)cyclohexyl]-2-methylhept-2-enoic acid (PubChem CID 139584678) has the molecular formula C15H26O6 and a molecular weight of 302.37 g/mol. Its IUPAC name is (E)-4,5,6-trihydroxy-6-[4-(hydroxymethyl)cyclohexyl]-2-methylhept-2-enoic acid.
| Compound Name | (E)-4,5,6-trihydroxy-6-[4-(hydroxymethyl)cyclohexyl]-2-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 139584678 |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (E)-4,5,6-trihydroxy-6-[4-(hydroxymethyl)cyclohexyl]-2-methylhept-2-enoic acid |
| SMILES | C/C(=C\C(O)C(O)C(C)(O)C1CCC(CO)CC1)C(=O)O |
| InChI | InChI=1S/C15H26O6/c1-9(14(19)20)7-12(17)13(18)15(2,21)11-5-3-10(8-16)4-6-11/h7,10-13,16-18,21H,3-6,8H2,1-2H3,(H,19,20)/b9-7+ |
| InChIKey | RXXXOLSHEDHXLP-VQHVLOKHSA-N |
| XLogP | 0.29 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|