C13H16O5 — CID 139584737
(4R,5S,6R,7R,10R)-4,6,7-trihydroxy-3-methylidene-10-[(E)-prop-1-enyl]-2-oxaspiro[4.5]dec-8-en-1-one (PubChem CID 139584737) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is (4R,5S,6R,7R,10R)-4,6,7-trihydroxy-3-methylidene-10-[(E)-prop-1-enyl]-2-oxaspiro[4.5]dec-8-en-1-one.
| Compound Name | (4R,5S,6R,7R,10R)-4,6,7-trihydroxy-3-methylidene-10-[(E)-prop-1-enyl]-2-oxaspiro[4.5]dec-8-en-1-one |
|---|---|
| PubChem CID | 139584737 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | (4R,5S,6R,7R,10R)-4,6,7-trihydroxy-3-methylidene-10-[(E)-prop-1-enyl]-2-oxaspiro[4.5]dec-8-en-1-one |
| SMILES | C=C1OC(=O)[C@]2([C@H](/C=C/C)C=C[C@@H](O)[C@@H]2O)[C@H]1O |
| InChI | InChI=1S/C13H16O5/c1-3-4-8-5-6-9(14)11(16)13(8)10(15)7(2)18-12(13)17/h3-6,8-11,14-16H,2H2,1H3/b4-3+/t8-,9-,10+,11+,13-/m1/s1 |
| InChIKey | GTLNIQXATYMDNB-MRRYNZKQSA-N |
| XLogP | -0.11 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|