C14H20O5 — CID 139584738
(7S)-7-hexyl-4-methoxy-7,7a-dihydro-4aH-furo[3,4-b]pyran-2,5-dione (PubChem CID 139584738) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is (7S)-7-hexyl-4-methoxy-7,7a-dihydro-4aH-furo[3,4-b]pyran-2,5-dione.
| Compound Name | (7S)-7-hexyl-4-methoxy-7,7a-dihydro-4aH-furo[3,4-b]pyran-2,5-dione |
|---|---|
| PubChem CID | 139584738 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (7S)-7-hexyl-4-methoxy-7,7a-dihydro-4aH-furo[3,4-b]pyran-2,5-dione |
| SMILES | CCCCCC[C@@H]1OC(=O)C2C(OC)=CC(=O)OC21 |
| InChI | InChI=1S/C14H20O5/c1-3-4-5-6-7-9-13-12(14(16)18-9)10(17-2)8-11(15)19-13/h8-9,12-13H,3-7H2,1-2H3/t9-,12?,13?/m0/s1 |
| InChIKey | YYPLKOPBIWJWCE-ALXWSUNGSA-N |
| XLogP | 1.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|