About (6R)-5,5-dimethyl-3-oxo-6-(3-oxobutyl)cyclohexene-1-carboxylic acid
(6R)-5,5-dimethyl-3-oxo-6-(3-oxobutyl)cyclohexene-1-carboxylic acid (PubChem CID 139584793) has the molecular formula C13H18O4
and a molecular weight of 238.28 g/mol. Its IUPAC name is (6R)-5,5-dimethyl-3-oxo-6-(3-oxobutyl)cyclohexene-1-carboxylic acid.
Molecular Properties
| Compound Name | (6R)-5,5-dimethyl-3-oxo-6-(3-oxobutyl)cyclohexene-1-carboxylic acid |
| PubChem CID | 139584793 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (6R)-5,5-dimethyl-3-oxo-6-(3-oxobutyl)cyclohexene-1-carboxylic acid |
| SMILES | CC(=O)CC[C@H]1C(C(=O)O)=CC(=O)CC1(C)C |
| InChI | InChI=1S/C13H18O4/c1-8(14)4-5-11-10(12(16)17)6-9(15)7-13(11,2)3/h6,11H,4-5,7H2,1-3H3,(H,16,17)/t11-/m0/s1 |
| InChIKey | YHNGXQALPYIXQZ-NSHDSACASA-N |
| XLogP | 1.98 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6R)-5,5-dimethyl-3-oxo-6-(3-oxobutyl)cyclohexene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-5,5-dimethyl-3-oxo-6-(3-oxobutyl)cyclohexene-1-carboxylic acid?
The IUPAC name of (6R)-5,5-dimethyl-3-oxo-6-(3-oxobutyl)cyclohexene-1-carboxylic acid (CID 139584793) is (6R)-5,5-dimethyl-3-oxo-6-(3-oxobutyl)cyclohexene-1-carboxylic acid.
What is the SMILES notation for (6R)-5,5-dimethyl-3-oxo-6-(3-oxobutyl)cyclohexene-1-carboxylic acid?
The canonical SMILES for (6R)-5,5-dimethyl-3-oxo-6-(3-oxobutyl)cyclohexene-1-carboxylic acid is CC(=O)CC[C@H]1C(C(=O)O)=CC(=O)CC1(C)C.
What is the InChIKey of (6R)-5,5-dimethyl-3-oxo-6-(3-oxobutyl)cyclohexene-1-carboxylic acid?
The InChIKey is YHNGXQALPYIXQZ-NSHDSACASA-N. The full InChI is InChI=1S/C13H18O4/c1-8(14)4-5-11-10(12(16)17)6-9(15)7-13(11,2)3/h6,11H,4-5,7H2,1-3H3,(H,16,17)/t11-/m0/s1.
What are the key properties of (6R)-5,5-dimethyl-3-oxo-6-(3-oxobutyl)cyclohexene-1-carboxylic acid?
(6R)-5,5-dimethyl-3-oxo-6-(3-oxobutyl)cyclohexene-1-carboxylic acid has a molecular weight of 238.28 g/mol, XLogP of 1.98, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-5,5-dimethyl-3-oxo-6-(3-oxobutyl)cyclohexene-1-carboxylic acid is sourced from PubChem (CID 139584793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).