C22H30O6 — CID 139584819
(E)-3-[(2S,3S)-3-[(2E,4E)-4,6-dimethyldodeca-2,4-dienoyl]oxy-6-oxo-2,3-dihydropyran-2-yl]prop-2-enoic acid (PubChem CID 139584819) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is (E)-3-[(2S,3S)-3-[(2E,4E)-4,6-dimethyldodeca-2,4-dienoyl]oxy-6-oxo-2,3-dihydropyran-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[(2S,3S)-3-[(2E,4E)-4,6-dimethyldodeca-2,4-dienoyl]oxy-6-oxo-2,3-dihydropyran-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 139584819 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | (E)-3-[(2S,3S)-3-[(2E,4E)-4,6-dimethyldodeca-2,4-dienoyl]oxy-6-oxo-2,3-dihydropyran-2-yl]prop-2-enoic acid |
| SMILES | CCCCCCC(C)/C=C(C)/C=C/C(=O)O[C@H]1C=CC(=O)O[C@H]1/C=C/C(=O)O |
| InChI | InChI=1S/C22H30O6/c1-4-5-6-7-8-16(2)15-17(3)9-13-21(25)28-19-11-14-22(26)27-18(19)10-12-20(23)24/h9-16,18-19H,4-8H2,1-3H3,(H,23,24)/b12-10+,13-9+,17-15+/t16?,18-,19-/m0/s1 |
| InChIKey | SZTWZPUAGRSHIP-MVUYCZRSSA-N |
| XLogP | 4.13 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|