C16H20O5 — CID 139584840
(3aS,4aR,5R,9aR)-3a,5-dihydroxy-9a-methoxy-4a,5-dimethyl-3-methylidene-4H-benzo[f][1]benzofuran-6-one (PubChem CID 139584840) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is (3aS,4aR,5R,9aR)-3a,5-dihydroxy-9a-methoxy-4a,5-dimethyl-3-methylidene-4H-benzo[f][1]benzofuran-6-one.
| Compound Name | (3aS,4aR,5R,9aR)-3a,5-dihydroxy-9a-methoxy-4a,5-dimethyl-3-methylidene-4H-benzo[f][1]benzofuran-6-one |
|---|---|
| PubChem CID | 139584840 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (3aS,4aR,5R,9aR)-3a,5-dihydroxy-9a-methoxy-4a,5-dimethyl-3-methylidene-4H-benzo[f][1]benzofuran-6-one |
| SMILES | C=C1CO[C@]2(OC)C=C3C=CC(=O)[C@](C)(O)[C@]3(C)C[C@]12O |
| InChI | InChI=1S/C16H20O5/c1-10-8-21-16(20-4)7-11-5-6-12(17)14(3,18)13(11,2)9-15(10,16)19/h5-7,18-19H,1,8-9H2,2-4H3/t13-,14+,15+,16-/m1/s1 |
| InChIKey | LTQBFDFZNQYYQL-FXUDXRNXSA-N |
| XLogP | 0.87 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|