C29H39NO2 — CID 139584961
10-hydroxy-7,15-dimethyl-20-octa-2,4-dienyl-1-azacycloicosa-3,5,7,11,13,15,17-heptaen-2-one (PubChem CID 139584961) has the molecular formula C29H39NO2 and a molecular weight of 433.64 g/mol. Its IUPAC name is 10-hydroxy-7,15-dimethyl-20-octa-2,4-dienyl-1-azacycloicosa-3,5,7,11,13,15,17-heptaen-2-one.
| Compound Name | 10-hydroxy-7,15-dimethyl-20-octa-2,4-dienyl-1-azacycloicosa-3,5,7,11,13,15,17-heptaen-2-one |
|---|---|
| PubChem CID | 139584961 |
| Molecular Formula | C29H39NO2 |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.30 |
| IUPAC Name | 10-hydroxy-7,15-dimethyl-20-octa-2,4-dienyl-1-azacycloicosa-3,5,7,11,13,15,17-heptaen-2-one |
| SMILES | CCCC=CC=CCC1CC=CC=C(C)C=CC=CC(O)CC=C(C)C=CC=CC(=O)N1 |
| InChI | InChI=1S/C29H39NO2/c1-4-5-6-7-8-9-19-27-20-13-10-16-25(2)17-11-14-21-28(31)24-23-26(3)18-12-15-22-29(32)30-27/h6-18,21-23,27-28,31H,4-5,19-20,24H2,1-3H3,(H,30,32) |
| InChIKey | QCDLQCCTHSWPBS-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|