C15H22O3 — CID 139585021
(3S,3aR,6S,7R,7aS)-1'-(hydroxymethyl)-3,6-dimethylspiro[3,3a,4,5,6,7a-hexahydro-1-benzofuran-7,3'-cyclopentene]-2-one (PubChem CID 139585021) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (3S,3aR,6S,7R,7aS)-1'-(hydroxymethyl)-3,6-dimethylspiro[3,3a,4,5,6,7a-hexahydro-1-benzofuran-7,3'-cyclopentene]-2-one.
| Compound Name | (3S,3aR,6S,7R,7aS)-1'-(hydroxymethyl)-3,6-dimethylspiro[3,3a,4,5,6,7a-hexahydro-1-benzofuran-7,3'-cyclopentene]-2-one |
|---|---|
| PubChem CID | 139585021 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (3S,3aR,6S,7R,7aS)-1'-(hydroxymethyl)-3,6-dimethylspiro[3,3a,4,5,6,7a-hexahydro-1-benzofuran-7,3'-cyclopentene]-2-one |
| SMILES | C[C@@H]1C(=O)O[C@H]2[C@@H]1CC[C@H](C)[C@]21C=C(CO)CC1 |
| InChI | InChI=1S/C15H22O3/c1-9-3-4-12-10(2)14(17)18-13(12)15(9)6-5-11(7-15)8-16/h7,9-10,12-13,16H,3-6,8H2,1-2H3/t9-,10-,12+,13-,15-/m0/s1 |
| InChIKey | VFSNSHDSAKLQJT-KKQCIPQASA-N |
| XLogP | 2.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|