C21H24N2O8 — CID 139585027
1,4,6-trimethyl-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9H-pyrido[3,2-g]quinoline-2,8-dione (PubChem CID 139585027) has the molecular formula C21H24N2O8 and a molecular weight of 432.43 g/mol. Its IUPAC name is 1,4,6-trimethyl-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9H-pyrido[3,2-g]quinoline-2,8-dione.
| Compound Name | 1,4,6-trimethyl-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9H-pyrido[3,2-g]quinoline-2,8-dione |
|---|---|
| PubChem CID | 139585027 |
| Molecular Formula | C21H24N2O8 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 1,4,6-trimethyl-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9H-pyrido[3,2-g]quinoline-2,8-dione |
| SMILES | Cc1cc(=O)[nH]c2c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c3c(cc12)c(C)cc(=O)n3C |
| InChI | InChI=1S/C21H24N2O8/c1-8-4-13(25)22-15-10(8)6-11-9(2)5-14(26)23(3)16(11)20(15)31-21-19(29)18(28)17(27)12(7-24)30-21/h4-6,12,17-19,21,24,27-29H,7H2,1-3H3,(H,22,25)/t12-,17-,18+,19-,21+/m1/s1 |
| InChIKey | WZSDZTIYWMMDGG-VIVOITHDSA-N |
| XLogP | -0.82 |
| TPSA | 154.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|