C15H18O5 — CID 139585028
(3aR,4aS,5S,9aS)-3a,5,9a-trihydroxy-4a,5-dimethyl-3-methylidene-4H-benzo[f][1]benzofuran-6-one (PubChem CID 139585028) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is (3aR,4aS,5S,9aS)-3a,5,9a-trihydroxy-4a,5-dimethyl-3-methylidene-4H-benzo[f][1]benzofuran-6-one.
| Compound Name | (3aR,4aS,5S,9aS)-3a,5,9a-trihydroxy-4a,5-dimethyl-3-methylidene-4H-benzo[f][1]benzofuran-6-one |
|---|---|
| PubChem CID | 139585028 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (3aR,4aS,5S,9aS)-3a,5,9a-trihydroxy-4a,5-dimethyl-3-methylidene-4H-benzo[f][1]benzofuran-6-one |
| SMILES | C=C1CO[C@@]2(O)C=C3C=CC(=O)[C@@](C)(O)[C@@]3(C)C[C@@]12O |
| InChI | InChI=1S/C15H18O5/c1-9-7-20-15(19)6-10-4-5-11(16)13(3,17)12(10,2)8-14(9,15)18/h4-6,17-19H,1,7-8H2,2-3H3/t12-,13+,14+,15-/m0/s1 |
| InChIKey | DZHGRAQTZQORPX-YJNKXOJESA-N |
| XLogP | 0.22 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|