C25H40 — CID 139585045
(1R,3S,7S,11S,12R)-1,8-dimethyl-12-[(2S)-6-methylhept-5-en-2-yl]-4-methylidenetricyclo[9.3.0.03,7]tetradec-8-ene (PubChem CID 139585045) has the molecular formula C25H40 and a molecular weight of 340.60 g/mol. Its IUPAC name is (1R,3S,7S,11S,12R)-1,8-dimethyl-12-[(2S)-6-methylhept-5-en-2-yl]-4-methylidenetricyclo[9.3.0.03,7]tetradec-8-ene.
| Compound Name | (1R,3S,7S,11S,12R)-1,8-dimethyl-12-[(2S)-6-methylhept-5-en-2-yl]-4-methylidenetricyclo[9.3.0.03,7]tetradec-8-ene |
|---|---|
| PubChem CID | 139585045 |
| Molecular Formula | C25H40 |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 340.31 |
| IUPAC Name | (1R,3S,7S,11S,12R)-1,8-dimethyl-12-[(2S)-6-methylhept-5-en-2-yl]-4-methylidenetricyclo[9.3.0.03,7]tetradec-8-ene |
| SMILES | C=C1CC[C@@H]2C(C)=CC[C@H]3[C@@H]([C@@H](C)CCC=C(C)C)CC[C@]3(C)C[C@H]12 |
| InChI | InChI=1S/C25H40/c1-17(2)8-7-9-18(3)22-14-15-25(6)16-23-20(5)10-12-21(23)19(4)11-13-24(22)25/h8,11,18,21-24H,5,7,9-10,12-16H2,1-4,6H3/t18-,21+,22+,23+,24-,25+/m0/s1 |
| InChIKey | LEKZSODPLNANJP-ZSNUMUKESA-N |
| XLogP | 7.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|