C28H40O5 — CID 139585059
(3E,5E,7E,9S,11E,13R,14R,15S,16R,17Z,19E,22S)-22-[(E)-but-1-enyl]-14,15,16-trihydroxy-5,9,13-trimethyl-1-oxacyclodocosa-3,5,7,11,17,19-hexaen-2-one (PubChem CID 139585059) has the molecular formula C28H40O5 and a molecular weight of 456.62 g/mol. Its IUPAC name is (3E,5E,7E,9S,11E,13R,14R,15S,16R,17Z,19E,22S)-22-[(E)-but-1-enyl]-14,15,16-trihydroxy-5,9,13-trimethyl-1-oxacyclodocosa-3,5,7,11,17,19-hexaen-2-one.
| Compound Name | (3E,5E,7E,9S,11E,13R,14R,15S,16R,17Z,19E,22S)-22-[(E)-but-1-enyl]-14,15,16-trihydroxy-5,9,13-trimethyl-1-oxacyclodocosa-3,5,7,11,17,19-hexaen-2-one |
|---|---|
| PubChem CID | 139585059 |
| Molecular Formula | C28H40O5 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | (3E,5E,7E,9S,11E,13R,14R,15S,16R,17Z,19E,22S)-22-[(E)-but-1-enyl]-14,15,16-trihydroxy-5,9,13-trimethyl-1-oxacyclodocosa-3,5,7,11,17,19-hexaen-2-one |
| SMILES | CC/C=C/[C@@H]1C/C=C/C=C\[C@@H](O)[C@H](O)[C@H](O)[C@H](C)/C=C/C[C@H](C)/C=C/C=C(C)/C=C/C(=O)O1 |
| InChI | InChI=1S/C28H40O5/c1-5-6-16-24-17-8-7-9-18-25(29)28(32)27(31)23(4)15-11-14-21(2)12-10-13-22(3)19-20-26(30)33-24/h6-13,15-16,18-21,23-25,27-29,31-32H,5,14,17H2,1-4H3/b8-7+,12-10+,15-11+,16-6+,18-9-,20-19+,22-13+/t21-,23-,24-,25-,27-,28+/m1/s1 |
| InChIKey | OYPWVSHNWVXFOC-XKOFLKQUSA-N |
| XLogP | 4.74 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|