C15H24O2 — CID 139585100
(1S,2R,3bR,6aS,7S,7aS)-1,5,5,7a-tetramethyl-2,3b,4,6,6a,7-hexahydro-1H-cyclopenta[a]pentalene-2,7-diol (PubChem CID 139585100) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (1S,2R,3bR,6aS,7S,7aS)-1,5,5,7a-tetramethyl-2,3b,4,6,6a,7-hexahydro-1H-cyclopenta[a]pentalene-2,7-diol.
| Compound Name | (1S,2R,3bR,6aS,7S,7aS)-1,5,5,7a-tetramethyl-2,3b,4,6,6a,7-hexahydro-1H-cyclopenta[a]pentalene-2,7-diol |
|---|---|
| PubChem CID | 139585100 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (1S,2R,3bR,6aS,7S,7aS)-1,5,5,7a-tetramethyl-2,3b,4,6,6a,7-hexahydro-1H-cyclopenta[a]pentalene-2,7-diol |
| SMILES | C[C@@H]1[C@H](O)C=C2[C@@H]3CC(C)(C)C[C@@H]3[C@H](O)[C@]21C |
| InChI | InChI=1S/C15H24O2/c1-8-12(16)5-11-9-6-14(2,3)7-10(9)13(17)15(8,11)4/h5,8-10,12-13,16-17H,6-7H2,1-4H3/t8-,9-,10+,12-,13+,15+/m1/s1 |
| InChIKey | QRVSAVYBBHXMDC-HIEKWVOZSA-N |
| XLogP | 2.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|