C38H54O7 — CID 139585175
methyl 2,6,10,15,19,23,23-heptamethyl-24-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]tetracosa-2,4,6,8,10,12,14,16,18,20-decaenoate (PubChem CID 139585175) has the molecular formula C38H54O7 and a molecular weight of 622.84 g/mol. Its IUPAC name is methyl 2,6,10,15,19,23,23-heptamethyl-24-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]tetracosa-2,4,6,8,10,12,14,16,18,20-decaenoate.
| Compound Name | methyl 2,6,10,15,19,23,23-heptamethyl-24-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]tetracosa-2,4,6,8,10,12,14,16,18,20-decaenoate |
|---|---|
| PubChem CID | 139585175 |
| Molecular Formula | C38H54O7 |
| Molecular Weight | 622.84 g/mol |
| Exact Mass | 622.39 |
| IUPAC Name | methyl 2,6,10,15,19,23,23-heptamethyl-24-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]tetracosa-2,4,6,8,10,12,14,16,18,20-decaenoate |
| SMILES | COC(=O)C(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CCC(C)(C)CC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C38H54O7/c1-27(17-11-19-29(3)21-13-23-31(5)37(43)44-8)15-9-10-16-28(2)18-12-20-30(4)22-14-24-38(6,7)25-32-34(40)36(42)35(41)33(26-39)45-32/h9-23,32-36,39-42H,24-26H2,1-8H3 |
| InChIKey | VVFBOZZJPYSOOO-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.84 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|