C24H30O5 — CID 139585252
(1R,5S,8R)-1,3,5-trimethyl-2-[(3E,5E)-2-oxohepta-3,5-dienyl]-8-[(E)-2-oxohept-5-enyl]-6-oxabicyclo[3.2.1]oct-2-ene-4,7-dione (PubChem CID 139585252) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is (1R,5S,8R)-1,3,5-trimethyl-2-[(3E,5E)-2-oxohepta-3,5-dienyl]-8-[(E)-2-oxohept-5-enyl]-6-oxabicyclo[3.2.1]oct-2-ene-4,7-dione.
| Compound Name | (1R,5S,8R)-1,3,5-trimethyl-2-[(3E,5E)-2-oxohepta-3,5-dienyl]-8-[(E)-2-oxohept-5-enyl]-6-oxabicyclo[3.2.1]oct-2-ene-4,7-dione |
|---|---|
| PubChem CID | 139585252 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | (1R,5S,8R)-1,3,5-trimethyl-2-[(3E,5E)-2-oxohepta-3,5-dienyl]-8-[(E)-2-oxohept-5-enyl]-6-oxabicyclo[3.2.1]oct-2-ene-4,7-dione |
| SMILES | C/C=C/C=C/C(=O)CC1=C(C)C(=O)[C@@]2(C)OC(=O)[C@]1(C)[C@H]2CC(=O)CC/C=C/C |
| InChI | InChI=1S/C24H30O5/c1-6-8-10-12-17(25)14-19-16(3)21(27)24(5)20(23(19,4)22(28)29-24)15-18(26)13-11-9-7-2/h6-10,12,20H,11,13-15H2,1-5H3/b8-6+,9-7+,12-10+/t20-,23+,24+/m1/s1 |
| InChIKey | ARDVREJTYZXHCH-NIBOASBDSA-N |
| XLogP | 4.23 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|