C14H18O5 — CID 139585308
(2S,6E,9Z)-11-hydroxy-14-oxo-1-oxacyclotetradeca-6,9,12-triene-2-carboxylic acid (PubChem CID 139585308) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is (2S,6E,9Z)-11-hydroxy-14-oxo-1-oxacyclotetradeca-6,9,12-triene-2-carboxylic acid.
| Compound Name | (2S,6E,9Z)-11-hydroxy-14-oxo-1-oxacyclotetradeca-6,9,12-triene-2-carboxylic acid |
|---|---|
| PubChem CID | 139585308 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | (2S,6E,9Z)-11-hydroxy-14-oxo-1-oxacyclotetradeca-6,9,12-triene-2-carboxylic acid |
| SMILES | O=C1C=CC(O)/C=C\C/C=C/CCC[C@@H](C(=O)O)O1 |
| InChI | InChI=1S/C14H18O5/c15-11-7-5-3-1-2-4-6-8-12(14(17)18)19-13(16)10-9-11/h1-2,5,7,9-12,15H,3-4,6,8H2,(H,17,18)/b2-1+,7-5-,10-9?/t11?,12-/m0/s1 |
| InChIKey | JHXMICLCFPBALC-WDYKEJGFSA-N |
| XLogP | 1.59 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|