C34H30O6 — CID 139585309
(1R,2S,4R,5S,6R,7S,9S)-7-benzyl-4,5,6-trihydroxy-2,5,9-triphenyl-8,10-dioxatricyclo[5.2.2.01,6]undecan-11-one (PubChem CID 139585309) has the molecular formula C34H30O6 and a molecular weight of 534.61 g/mol. Its IUPAC name is (1R,2S,4R,5S,6R,7S,9S)-7-benzyl-4,5,6-trihydroxy-2,5,9-triphenyl-8,10-dioxatricyclo[5.2.2.01,6]undecan-11-one.
| Compound Name | (1R,2S,4R,5S,6R,7S,9S)-7-benzyl-4,5,6-trihydroxy-2,5,9-triphenyl-8,10-dioxatricyclo[5.2.2.01,6]undecan-11-one |
|---|---|
| PubChem CID | 139585309 |
| Molecular Formula | C34H30O6 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | (1R,2S,4R,5S,6R,7S,9S)-7-benzyl-4,5,6-trihydroxy-2,5,9-triphenyl-8,10-dioxatricyclo[5.2.2.01,6]undecan-11-one |
| SMILES | O=C1O[C@@]23[C@H](c4ccccc4)C[C@@H](O)[C@@](O)(c4ccccc4)[C@]2(O)[C@]1(Cc1ccccc1)O[C@H]3c1ccccc1 |
| InChI | InChI=1S/C34H30O6/c35-28-21-27(24-15-7-2-8-16-24)33-29(25-17-9-3-10-18-25)39-31(30(36)40-33,22-23-13-5-1-6-14-23)34(33,38)32(28,37)26-19-11-4-12-20-26/h1-20,27-29,35,37-38H,21-22H2/t27-,28+,29-,31+,32-,33+,34+/m0/s1 |
| InChIKey | ZRTHDXCISSSDQB-JQQVBRSKSA-N |
| XLogP | 4.20 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |