C20H30O2 — CID 139585342
(1S,2S,5S,7S,10R,11R)-5-ethenyl-2,5,11-trimethyl-15-oxatetracyclo[9.3.2.01,10.02,7]hexadecan-16-one (PubChem CID 139585342) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (1S,2S,5S,7S,10R,11R)-5-ethenyl-2,5,11-trimethyl-15-oxatetracyclo[9.3.2.01,10.02,7]hexadecan-16-one.
| Compound Name | (1S,2S,5S,7S,10R,11R)-5-ethenyl-2,5,11-trimethyl-15-oxatetracyclo[9.3.2.01,10.02,7]hexadecan-16-one |
|---|---|
| PubChem CID | 139585342 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (1S,2S,5S,7S,10R,11R)-5-ethenyl-2,5,11-trimethyl-15-oxatetracyclo[9.3.2.01,10.02,7]hexadecan-16-one |
| SMILES | C=C[C@@]1(C)CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@]4(C)CCC[C@]32OC4=O)C1 |
| InChI | InChI=1S/C20H30O2/c1-5-17(2)11-12-19(4)14(13-17)7-8-15-18(3)9-6-10-20(15,19)22-16(18)21/h5,14-15H,1,6-13H2,2-4H3/t14-,15+,17-,18+,19-,20-/m0/s1 |
| InChIKey | CTCROMXVKZUKQD-BVTPCJTOSA-N |
| XLogP | 4.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|