C18H18O5 — CID 139585356
6-but-1-enyl-2-propyl-4,12-dioxatricyclo[8.3.0.03,7]trideca-1(10),2,6-triene-5,11,13-trione (PubChem CID 139585356) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is 6-but-1-enyl-2-propyl-4,12-dioxatricyclo[8.3.0.03,7]trideca-1(10),2,6-triene-5,11,13-trione.
| Compound Name | 6-but-1-enyl-2-propyl-4,12-dioxatricyclo[8.3.0.03,7]trideca-1(10),2,6-triene-5,11,13-trione |
|---|---|
| PubChem CID | 139585356 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 6-but-1-enyl-2-propyl-4,12-dioxatricyclo[8.3.0.03,7]trideca-1(10),2,6-triene-5,11,13-trione |
| SMILES | CCC=CC1=C2CCC3=C(C(=O)OC3=O)C(CCC)=C2OC1=O |
| InChI | InChI=1S/C18H18O5/c1-3-5-7-11-10-8-9-13-14(18(21)23-17(13)20)12(6-4-2)15(10)22-16(11)19/h5,7H,3-4,6,8-9H2,1-2H3 |
| InChIKey | LZVAVELRNPTDSM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|