About 9-[2-amino-3-(3,4-dihydroxy-5-methoxy-6-methyloxan-2-yl)oxyphenyl]nonanoic acid
9-[2-amino-3-(3,4-dihydroxy-5-methoxy-6-methyloxan-2-yl)oxyphenyl]nonanoic acid (PubChem CID 139585424) has the molecular formula C22H35NO7
and a molecular weight of 425.52 g/mol. Its IUPAC name is 9-[2-amino-3-(3,4-dihydroxy-5-methoxy-6-methyloxan-2-yl)oxyphenyl]nonanoic acid.
Molecular Properties
| Compound Name | 9-[2-amino-3-(3,4-dihydroxy-5-methoxy-6-methyloxan-2-yl)oxyphenyl]nonanoic acid |
| PubChem CID | 139585424 |
| Molecular Formula | C22H35NO7 |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 9-[2-amino-3-(3,4-dihydroxy-5-methoxy-6-methyloxan-2-yl)oxyphenyl]nonanoic acid |
| SMILES | COC1C(C)OC(Oc2cccc(CCCCCCCCC(=O)O)c2N)C(O)C1O |
| InChI | InChI=1S/C22H35NO7/c1-14-21(28-2)19(26)20(27)22(29-14)30-16-12-9-11-15(18(16)23)10-7-5-3-4-6-8-13-17(24)25/h9,11-12,14,19-22,26-27H,3-8,10,13,23H2,1-2H3,(H,24,25) |
| InChIKey | QBDYOKIMEDJTMQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 9-[2-amino-3-(3,4-dihydroxy-5-methoxy-6-methyloxan-2-yl)oxyphenyl]nonanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[2-amino-3-(3,4-dihydroxy-5-methoxy-6-methyloxan-2-yl)oxyphenyl]nonanoic acid?
The IUPAC name of 9-[2-amino-3-(3,4-dihydroxy-5-methoxy-6-methyloxan-2-yl)oxyphenyl]nonanoic acid (CID 139585424) is 9-[2-amino-3-(3,4-dihydroxy-5-methoxy-6-methyloxan-2-yl)oxyphenyl]nonanoic acid.
What is the SMILES notation for 9-[2-amino-3-(3,4-dihydroxy-5-methoxy-6-methyloxan-2-yl)oxyphenyl]nonanoic acid?
The canonical SMILES for 9-[2-amino-3-(3,4-dihydroxy-5-methoxy-6-methyloxan-2-yl)oxyphenyl]nonanoic acid is COC1C(C)OC(Oc2cccc(CCCCCCCCC(=O)O)c2N)C(O)C1O.
What is the InChIKey of 9-[2-amino-3-(3,4-dihydroxy-5-methoxy-6-methyloxan-2-yl)oxyphenyl]nonanoic acid?
The InChIKey is QBDYOKIMEDJTMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H35NO7/c1-14-21(28-2)19(26)20(27)22(29-14)30-16-12-9-11-15(18(16)23)10-7-5-3-4-6-8-13-17(24)25/h9,11-12,14,19-22,26-27H,3-8,10,13,23H2,1-2H3,(H,24,25).
What are the key properties of 9-[2-amino-3-(3,4-dihydroxy-5-methoxy-6-methyloxan-2-yl)oxyphenyl]nonanoic acid?
9-[2-amino-3-(3,4-dihydroxy-5-methoxy-6-methyloxan-2-yl)oxyphenyl]nonanoic acid has a molecular weight of 425.52 g/mol, XLogP of 2.49, 12 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[2-amino-3-(3,4-dihydroxy-5-methoxy-6-methyloxan-2-yl)oxyphenyl]nonanoic acid is sourced from PubChem (CID 139585424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).